C16H21N3O8 — CID 122686175
[2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl]-4-nitrophenyl] hydrogen carbonate (PubChem CID 122686175) has the molecular formula C16H21N3O8 and a molecular weight of 383.36 g/mol. Its IUPAC name is [2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl]-4-nitrophenyl] hydrogen carbonate.
| Compound Name | [2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl]-4-nitrophenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 122686175 |
| Molecular Formula | C16H21N3O8 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [2-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl]-4-nitrophenyl] hydrogen carbonate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCc1cc([N+](=O)[O-])ccc1OC(=O)O |
| InChI | InChI=1S/C16H21N3O8/c1-16(2,3)27-14(21)18-9-13(20)17-7-6-10-8-11(19(24)25)4-5-12(10)26-15(22)23/h4-5,8H,6-7,9H2,1-3H3,(H,17,20)(H,18,21)(H,22,23) |
| InChIKey | SGGXLVPJUIRGMY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|