C25H31N3O8 — CID 69033552
[2-[[4-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl]-4-nitrophenyl] hydrogen carbonate (PubChem CID 69033552) has the molecular formula C25H31N3O8 and a molecular weight of 501.54 g/mol. Its IUPAC name is [2-[[4-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl]-4-nitrophenyl] hydrogen carbonate.
| Compound Name | [2-[[4-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl]-4-nitrophenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 69033552 |
| Molecular Formula | C25H31N3O8 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | [2-[[4-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl]-4-nitrophenyl] hydrogen carbonate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccc(Cc2cc([N+](=O)[O-])ccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C25H31N3O8/c1-15(2)12-20(27-23(30)36-25(3,4)5)22(29)26-18-8-6-16(7-9-18)13-17-14-19(28(33)34)10-11-21(17)35-24(31)32/h6-11,14-15,20H,12-13H2,1-5H3,(H,26,29)(H,27,30)(H,31,32)/t20-/m0/s1 |
| InChIKey | SJVALIMUDHCUAB-FQEVSTJZSA-N |
| XLogP | 5.12 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|