C27H34N4O11 — CID 156689932
bis[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-nitrophenyl] carbonate (PubChem CID 156689932) has the molecular formula C27H34N4O11 and a molecular weight of 590.59 g/mol. Its IUPAC name is bis[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-nitrophenyl] carbonate.
| Compound Name | bis[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-nitrophenyl] carbonate |
|---|---|
| PubChem CID | 156689932 |
| Molecular Formula | C27H34N4O11 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | bis[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-nitrophenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)NCCc1cc([N+](=O)[O-])ccc1OC(=O)Oc1ccc([N+](=O)[O-])cc1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H34N4O11/c1-26(2,3)41-23(32)28-13-11-17-15-19(30(35)36)7-9-21(17)39-25(34)40-22-10-8-20(31(37)38)16-18(22)12-14-29-24(33)42-27(4,5)6/h7-10,15-16H,11-14H2,1-6H3,(H,28,32)(H,29,33) |
| InChIKey | QXVMFCAAROZFRT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 198.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|