C19H29N3O8S — CID 58860353
[2-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl]-5-nitrophenyl]methyl methanesulfonate (PubChem CID 58860353) has the molecular formula C19H29N3O8S and a molecular weight of 459.52 g/mol. Its IUPAC name is [2-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl]-5-nitrophenyl]methyl methanesulfonate.
| Compound Name | [2-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl]-5-nitrophenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 58860353 |
| Molecular Formula | C19H29N3O8S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [2-[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyl]-5-nitrophenyl]methyl methanesulfonate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCc1ccc([N+](=O)[O-])cc1COS(C)(=O)=O |
| InChI | InChI=1S/C19H29N3O8S/c1-6-16(21-18(24)30-19(2,3)4)17(23)20-10-9-13-7-8-15(22(25)26)11-14(13)12-29-31(5,27)28/h7-8,11,16H,6,9-10,12H2,1-5H3,(H,20,23)(H,21,24)/t16-/m0/s1 |
| InChIKey | URKCBNPDXRKLJK-INIZCTEOSA-N |
| XLogP | 2.03 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|