C10H9ClN2O4 — CID 14880548
2-chloro-1-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone (PubChem CID 14880548) has the molecular formula C10H9ClN2O4 and a molecular weight of 256.64 g/mol. Its IUPAC name is 2-chloro-1-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone.
| Compound Name | 2-chloro-1-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone |
|---|---|
| PubChem CID | 14880548 |
| Molecular Formula | C10H9ClN2O4 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-chloro-1-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone |
| SMILES | O=C(CCl)N1CCOc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C10H9ClN2O4/c11-6-10(14)12-3-4-17-9-5-7(13(15)16)1-2-8(9)12/h1-2,5H,3-4,6H2 |
| InChIKey | IQVWEUCVJPLEIF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|