C21H37N3O3 — CID 172622661
ethane;4-[(1-methylpiperidin-4-yl)methyl]-7-nitro-2,3-dihydro-1,4-benzoxazine;2-methylpropane (PubChem CID 172622661) has the molecular formula C21H37N3O3 and a molecular weight of 379.55 g/mol. Its IUPAC name is ethane;4-[(1-methylpiperidin-4-yl)methyl]-7-nitro-2,3-dihydro-1,4-benzoxazine;2-methylpropane.
| Compound Name | ethane;4-[(1-methylpiperidin-4-yl)methyl]-7-nitro-2,3-dihydro-1,4-benzoxazine;2-methylpropane |
|---|---|
| PubChem CID | 172622661 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | ethane;4-[(1-methylpiperidin-4-yl)methyl]-7-nitro-2,3-dihydro-1,4-benzoxazine;2-methylpropane |
| SMILES | CC.CC(C)C.CN1CCC(CN2CCOc3cc([N+](=O)[O-])ccc32)CC1 |
| InChI | InChI=1S/C15H21N3O3.C4H10.C2H6/c1-16-6-4-12(5-7-16)11-17-8-9-21-15-10-13(18(19)20)2-3-14(15)17;1-4(2)3;1-2/h2-3,10,12H,4-9,11H2,1H3;4H,1-3H3;1-2H3 |
| InChIKey | CDIQBSXWKAKILF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|