C15H21N3O4S — CID 174735074
tert-butyl N-[2-(6-nitro-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]carbamate (PubChem CID 174735074) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is tert-butyl N-[2-(6-nitro-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(6-nitro-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 174735074 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | tert-butyl N-[2-(6-nitro-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCSc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H21N3O4S/c1-15(2,3)22-14(19)16-6-7-17-8-9-23-13-5-4-11(18(20)21)10-12(13)17/h4-5,10H,6-9H2,1-3H3,(H,16,19) |
| InChIKey | ZXKNVICKWOYCIT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|