C17H22N2O5 — CID 169428200
(E)-but-2-enedioic acid;4-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 169428200) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | (E)-but-2-enedioic acid;4-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 169428200 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (E)-but-2-enedioic acid;4-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | CN1CCOc2cc3c(cc21)CCNCC3.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H18N2O.C4H4O4/c1-15-6-7-16-13-9-11-3-5-14-4-2-10(11)8-12(13)15;5-3(6)1-2-4(7)8/h8-9,14H,2-7H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HGUONWWTEHSXEW-WLHGVMLRSA-N |
| XLogP | 0.92 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|