C23H28N4O6 — CID 162329729
(E)-but-2-enedioic acid;5-methyl-4-(2-pyrazin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 162329729) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-methyl-4-(2-pyrazin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | (E)-but-2-enedioic acid;5-methyl-4-(2-pyrazin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 162329729 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (E)-but-2-enedioic acid;5-methyl-4-(2-pyrazin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | Cc1c2c(cc3c1N(CCOc1cnccn1)CCO3)CCNCC2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H24N4O2.C4H4O4/c1-14-16-3-5-20-4-2-15(16)12-17-19(14)23(8-10-24-17)9-11-25-18-13-21-6-7-22-18;5-3(6)1-2-4(7)8/h6-7,12-13,20H,2-5,8-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BNGJUVNZOGYMGN-WLHGVMLRSA-N |
| XLogP | 1.46 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|