C21H18F3NO3 — CID 91431366
5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 91431366) has the molecular formula C21H18F3NO3 and a molecular weight of 389.37 g/mol. Its IUPAC name is 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91431366 |
| Molecular Formula | C21H18F3NO3 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | CN1CCOc2cc(C(=CC=CC(=O)O)c3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C21H18F3NO3/c1-25-11-12-28-19-13-15(7-10-18(19)25)17(3-2-4-20(26)27)14-5-8-16(9-6-14)21(22,23)24/h2-10,13H,11-12H2,1H3,(H,26,27) |
| InChIKey | WPAKNRZCUQSDBF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|