C20H27N3O5 — CID 66982144
but-2-enedioic acid;N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[2,3-h][3]benzazepine-1-carboxamide (PubChem CID 66982144) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is but-2-enedioic acid;N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[2,3-h][3]benzazepine-1-carboxamide.
| Compound Name | but-2-enedioic acid;N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[2,3-h][3]benzazepine-1-carboxamide |
|---|---|
| PubChem CID | 66982144 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | but-2-enedioic acid;N,N-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[2,3-h][3]benzazepine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCCc2cc3c(cc21)CCNCC3.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H23N3O.C4H4O4/c1-18(2)16(20)19-9-3-4-14-10-12-5-7-17-8-6-13(12)11-15(14)19;5-3(6)1-2-4(7)8/h10-11,17H,3-9H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | ZLCXHFSDNRARGB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|