C18H26N4O2 — CID 82549978
1-(1-acetyl-7-amino-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-one (PubChem CID 82549978) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-(1-acetyl-7-amino-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-one.
| Compound Name | 1-(1-acetyl-7-amino-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 82549978 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-(1-acetyl-7-amino-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-one |
| SMILES | CC(=O)N1CCCc2cc(C(=O)CCN3CCNCC3)c(N)cc21 |
| InChI | InChI=1S/C18H26N4O2/c1-13(23)22-7-2-3-14-11-15(16(19)12-17(14)22)18(24)4-8-21-9-5-20-6-10-21/h11-12,20H,2-10,19H2,1H3 |
| InChIKey | UEPMZFBLJCJGGN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|