C17H23N3O2 — CID 82136459
1-(1-acetyl-2,3-dihydroindol-5-yl)-3-piperazin-1-ylpropan-1-one (PubChem CID 82136459) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-piperazin-1-ylpropan-1-one.
| Compound Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 82136459 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-piperazin-1-ylpropan-1-one |
| SMILES | CC(=O)N1CCc2cc(C(=O)CCN3CCNCC3)ccc21 |
| InChI | InChI=1S/C17H23N3O2/c1-13(21)20-9-4-14-12-15(2-3-16(14)20)17(22)5-8-19-10-6-18-7-11-19/h2-3,12,18H,4-11H2,1H3 |
| InChIKey | WBRDGFCEKWJVLE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |