C18H21BrN2O5 — CID 162324819
11-bromo-1-methyl-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid (PubChem CID 162324819) has the molecular formula C18H21BrN2O5 and a molecular weight of 425.28 g/mol. Its IUPAC name is 11-bromo-1-methyl-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid.
| Compound Name | 11-bromo-1-methyl-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 162324819 |
| Molecular Formula | C18H21BrN2O5 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 11-bromo-1-methyl-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid |
| SMILES | CN1C(=O)CCc2cc3c(c(Br)c21)CCNCC3.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H17BrN2O.C4H4O4/c1-17-12(18)3-2-10-8-9-4-6-16-7-5-11(9)13(15)14(10)17;5-3(6)1-2-4(7)8/h8,16H,2-7H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | WSBYJACMMFEJLU-WLHGVMLRSA-N |
| XLogP | 1.76 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|