C21H27BrN2O6 — CID 162305457
11-bromo-1-(3-methoxypropyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid (PubChem CID 162305457) has the molecular formula C21H27BrN2O6 and a molecular weight of 483.36 g/mol. Its IUPAC name is 11-bromo-1-(3-methoxypropyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid.
| Compound Name | 11-bromo-1-(3-methoxypropyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 162305457 |
| Molecular Formula | C21H27BrN2O6 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 11-bromo-1-(3-methoxypropyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one;(E)-but-2-enedioic acid |
| SMILES | COCCCN1C(=O)CCc2cc3c(c(Br)c21)CCNCC3.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H23BrN2O2.C4H4O4/c1-22-10-2-9-20-15(21)4-3-13-11-12-5-7-19-8-6-14(12)16(18)17(13)20;5-3(6)1-2-4(7)8/h11,19H,2-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | JAWSKMZGTWRKHX-WLHGVMLRSA-N |
| XLogP | 2.16 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|