C17H21ClN2O4 — CID 169425399
(E)-but-2-enedioic acid;11-chloro-2,3,4,6,7,8,9,10-octahydro-1H-pyrido[2,3-h][3]benzazepine (PubChem CID 169425399) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;11-chloro-2,3,4,6,7,8,9,10-octahydro-1H-pyrido[2,3-h][3]benzazepine.
| Compound Name | (E)-but-2-enedioic acid;11-chloro-2,3,4,6,7,8,9,10-octahydro-1H-pyrido[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 169425399 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (E)-but-2-enedioic acid;11-chloro-2,3,4,6,7,8,9,10-octahydro-1H-pyrido[2,3-h][3]benzazepine |
| SMILES | Clc1c2c(cc3c1NCCC3)CCNCC2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H17ClN2.C4H4O4/c14-12-11-4-7-15-6-3-9(11)8-10-2-1-5-16-13(10)12;5-3(6)1-2-4(7)8/h8,15-16H,1-7H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PWHWOCNJNLJANY-WLHGVMLRSA-N |
| XLogP | 2.10 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|