C16H15NO2 — CID 67893760
6-phenyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid (PubChem CID 67893760) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-phenyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid.
| Compound Name | 6-phenyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 67893760 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-phenyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2)cc2c1NCCC2 |
| InChI | InChI=1S/C16H15NO2/c18-16(19)14-10-13(11-5-2-1-3-6-11)9-12-7-4-8-17-15(12)14/h1-3,5-6,9-10,17H,4,7-8H2,(H,18,19) |
| InChIKey | ZCWJSKGRUOMMQT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |