C10H11NO3 — CID 171080337
7-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxylic acid (PubChem CID 171080337) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 7-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxylic acid.
| Compound Name | 7-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 171080337 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 7-hydroxy-1,2,3,4-tetrahydroquinoline-6-carboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1O)NCCC2 |
| InChI | InChI=1S/C10H11NO3/c12-9-5-8-6(2-1-3-11-8)4-7(9)10(13)14/h4-5,11-12H,1-3H2,(H,13,14) |
| InChIKey | BMPAPPDTHVJVMH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |