6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid

C9H8FNO2 — CID 130704446

IUPAC6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid
SMILESO=C(O)c1cc2c(cc1F)NCC2
InChIInChI=1S/C9H8FNO2/c10-7-4-8-5(1-2-11-8)3-6(7)9(12)13/h3-4,11H,1-2H2,(H,12,13)
InChIKeyFXRTXEWCLVQQMI-UHFFFAOYSA-N
MW181.17 g/mol
LogP1.49
Rot. Bonds1

About 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid

6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid (PubChem CID 130704446) has the molecular formula C9H8FNO2 and a molecular weight of 181.17 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid.

Molecular Properties

Compound Name6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid
PubChem CID130704446
Molecular FormulaC9H8FNO2
Molecular Weight181.17 g/mol
Exact Mass181.05
IUPAC Name6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid
SMILESO=C(O)c1cc2c(cc1F)NCC2
InChIInChI=1S/C9H8FNO2/c10-7-4-8-5(1-2-11-8)3-6(7)9(12)13/h3-4,11H,1-2H2,(H,12,13)
InChIKeyFXRTXEWCLVQQMI-UHFFFAOYSA-N
XLogP1.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.17
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(Hexadecylamino)benzoic acid
CID 47263
4-(Methylamino)benzoic acid
CID 66345
4-(Butylamino)benzoic acid
CID 95946
4-(Benzylamino)benzoic acid
CID 853546
1,2,3,4-Tetrahydroquinoline-6-carboxylic acid
CID 2779641
4-[(Carboxymethyl)amino]benzoic acid
CID 225483
3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4,8-dicarboxylic acid
CID 4039540
4-(Allylamino)benzoic acid
CID 283473
4-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid
CID 2839743
4-(Ethylamino)benzoic acid
CID 2775249
2-Oxindole-5-carboxylic acid
CID 2773318
1-methanesulfonyl-2,3-dihydro-1H-indole-5-carboxylic acid
CID 974447

Frequently Asked Questions

What is the IUPAC name of 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid?
The IUPAC name of 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid (CID 130704446) is 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid.
What is the SMILES notation for 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid?
The canonical SMILES for 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid is O=C(O)c1cc2c(cc1F)NCC2.
What is the InChIKey of 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid?
The InChIKey is FXRTXEWCLVQQMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2/c10-7-4-8-5(1-2-11-8)3-6(7)9(12)13/h3-4,11H,1-2H2,(H,12,13).
What are the key properties of 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid?
6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid has a molecular weight of 181.17 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,3-dihydro-1H-indole-5-carboxylic acid is sourced from PubChem (CID 130704446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).