C10H9Cl2NO — CID 87795518
2-chloro-1-(6-chloro-2,3-dihydro-1H-indol-5-yl)ethanone (PubChem CID 87795518) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is 2-chloro-1-(6-chloro-2,3-dihydro-1H-indol-5-yl)ethanone.
| Compound Name | 2-chloro-1-(6-chloro-2,3-dihydro-1H-indol-5-yl)ethanone |
|---|---|
| PubChem CID | 87795518 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-chloro-1-(6-chloro-2,3-dihydro-1H-indol-5-yl)ethanone |
| SMILES | O=C(CCl)c1cc2c(cc1Cl)NCC2 |
| InChI | InChI=1S/C10H9Cl2NO/c11-5-10(14)7-3-6-1-2-13-9(6)4-8(7)12/h3-4,13H,1-2,5H2 |
| InChIKey | FFQIGZXURKMYCH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|