C8H7ClN2O2 — CID 126455496
5-chloro-6-nitro-2,3-dihydro-1H-indole (PubChem CID 126455496) has the molecular formula C8H7ClN2O2 and a molecular weight of 198.61 g/mol. Its IUPAC name is 5-chloro-6-nitro-2,3-dihydro-1H-indole.
| Compound Name | 5-chloro-6-nitro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 126455496 |
| Molecular Formula | C8H7ClN2O2 |
| Molecular Weight | 198.61 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 5-chloro-6-nitro-2,3-dihydro-1H-indole |
| SMILES | O=[N+]([O-])c1cc2c(cc1Cl)CCN2 |
| InChI | InChI=1S/C8H7ClN2O2/c9-6-3-5-1-2-10-7(5)4-8(6)11(12)13/h3-4,10H,1-2H2 |
| InChIKey | SOMADCPMWAGDKT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|