C13H16ClNO2 — CID 142365880
3-chloro-2-nitro-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene (PubChem CID 142365880) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 3-chloro-2-nitro-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene.
| Compound Name | 3-chloro-2-nitro-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene |
|---|---|
| PubChem CID | 142365880 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-chloro-2-nitro-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene |
| SMILES | O=[N+]([O-])c1cc2c(cc1Cl)CCCCCCC2 |
| InChI | InChI=1S/C13H16ClNO2/c14-12-8-10-6-4-2-1-3-5-7-11(10)9-13(12)15(16)17/h8-9H,1-7H2 |
| InChIKey | ZKKSXZGYBPZNIV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|