C8H5ClN2O3 — CID 141362608
5-chloro-6-nitro-1,3-dihydroindol-2-one (PubChem CID 141362608) has the molecular formula C8H5ClN2O3 and a molecular weight of 212.59 g/mol. Its IUPAC name is 5-chloro-6-nitro-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-6-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 141362608 |
| Molecular Formula | C8H5ClN2O3 |
| Molecular Weight | 212.59 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 5-chloro-6-nitro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(Cl)c([N+](=O)[O-])cc2N1 |
| InChI | InChI=1S/C8H5ClN2O3/c9-5-1-4-2-8(12)10-6(4)3-7(5)11(13)14/h1,3H,2H2,(H,10,12) |
| InChIKey | AKVAEDLMYKKRLK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.59 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|