C11H11N3O4 — CID 63105926
6-(azetidin-3-yloxy)-5-nitro-1,3-dihydroindol-2-one (PubChem CID 63105926) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 6-(azetidin-3-yloxy)-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 6-(azetidin-3-yloxy)-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63105926 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 6-(azetidin-3-yloxy)-5-nitro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc([N+](=O)[O-])c(OC3CNC3)cc2N1 |
| InChI | InChI=1S/C11H11N3O4/c15-11-2-6-1-9(14(16)17)10(3-8(6)13-11)18-7-4-12-5-7/h1,3,7,12H,2,4-5H2,(H,13,15) |
| InChIKey | QJXUHOYFQIBRGB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|