C15H19N3O3 — CID 43451829
6-(cycloheptylamino)-5-nitro-1,3-dihydroindol-2-one (PubChem CID 43451829) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 6-(cycloheptylamino)-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 6-(cycloheptylamino)-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43451829 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 6-(cycloheptylamino)-5-nitro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc([N+](=O)[O-])c(NC3CCCCCC3)cc2N1 |
| InChI | InChI=1S/C15H19N3O3/c19-15-8-10-7-14(18(20)21)13(9-12(10)17-15)16-11-5-3-1-2-4-6-11/h7,9,11,16H,1-6,8H2,(H,17,19) |
| InChIKey | UMBYPRPOTLPSGI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|