C11H9N3O3 — CID 62141089
5-nitro-6-(prop-2-ynylamino)-1,3-dihydroindol-2-one (PubChem CID 62141089) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 5-nitro-6-(prop-2-ynylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-nitro-6-(prop-2-ynylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 62141089 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-nitro-6-(prop-2-ynylamino)-1,3-dihydroindol-2-one |
| SMILES | C#CCNc1cc2c(cc1[N+](=O)[O-])CC(=O)N2 |
| InChI | InChI=1S/C11H9N3O3/c1-2-3-12-9-6-8-7(5-11(15)13-8)4-10(9)14(16)17/h1,4,6,12H,3,5H2,(H,13,15) |
| InChIKey | WLHFPMVYAVHNKK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|