C11H12N4O5 — CID 83204859
2-[(5-nitro-2-oxo-1,3-dihydroindol-6-yl)amino]ethyl carbamate (PubChem CID 83204859) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-[(5-nitro-2-oxo-1,3-dihydroindol-6-yl)amino]ethyl carbamate.
| Compound Name | 2-[(5-nitro-2-oxo-1,3-dihydroindol-6-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83204859 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[(5-nitro-2-oxo-1,3-dihydroindol-6-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1cc2c(cc1[N+](=O)[O-])CC(=O)N2 |
| InChI | InChI=1S/C11H12N4O5/c12-11(17)20-2-1-13-8-5-7-6(4-10(16)14-7)3-9(8)15(18)19/h3,5,13H,1-2,4H2,(H2,12,17)(H,14,16) |
| InChIKey | GPIXFSJLKHUDOD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|