C9H5F3N2O3 — CID 154202750
5-nitro-6-(trifluoromethyl)-1,3-dihydroindol-2-one (PubChem CID 154202750) has the molecular formula C9H5F3N2O3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 5-nitro-6-(trifluoromethyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-nitro-6-(trifluoromethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 154202750 |
| Molecular Formula | C9H5F3N2O3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-nitro-6-(trifluoromethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc([N+](=O)[O-])c(C(F)(F)F)cc2N1 |
| InChI | InChI=1S/C9H5F3N2O3/c10-9(11,12)5-3-6-4(2-8(15)13-6)1-7(5)14(16)17/h1,3H,2H2,(H,13,15) |
| InChIKey | XLSAHMLNCXUKQT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|