C8H6BrNO2 — CID 130836892
3-bromo-4-nitrobicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 130836892) has the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. Its IUPAC name is 3-bromo-4-nitrobicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 3-bromo-4-nitrobicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 130836892 |
| Molecular Formula | C8H6BrNO2 |
| Molecular Weight | 228.04 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | 3-bromo-4-nitrobicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | O=[N+]([O-])c1cc2c(cc1Br)CC2 |
| InChI | InChI=1S/C8H6BrNO2/c9-7-3-5-1-2-6(5)4-8(7)10(11)12/h3-4H,1-2H2 |
| InChIKey | GSFLCAMNCPTAFQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.04 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|