C9H7BrN2O4 — CID 12887052
5-bromo-4,6-dinitro-2,3-dihydro-1H-indene (PubChem CID 12887052) has the molecular formula C9H7BrN2O4 and a molecular weight of 287.07 g/mol. Its IUPAC name is 5-bromo-4,6-dinitro-2,3-dihydro-1H-indene.
| Compound Name | 5-bromo-4,6-dinitro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 12887052 |
| Molecular Formula | C9H7BrN2O4 |
| Molecular Weight | 287.07 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 5-bromo-4,6-dinitro-2,3-dihydro-1H-indene |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1Br)CCC2 |
| InChI | InChI=1S/C9H7BrN2O4/c10-8-7(11(13)14)4-5-2-1-3-6(5)9(8)12(15)16/h4H,1-3H2 |
| InChIKey | FZGKIBDZGMTQEZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.07 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|