C14H15NO2 — CID 162394434
8-nitrospiro[2,3,5,6-tetrahydro-1H-s-indacene-7,1'-cyclopropane] (PubChem CID 162394434) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 8-nitrospiro[2,3,5,6-tetrahydro-1H-s-indacene-7,1'-cyclopropane].
| Compound Name | 8-nitrospiro[2,3,5,6-tetrahydro-1H-s-indacene-7,1'-cyclopropane] |
|---|---|
| PubChem CID | 162394434 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 8-nitrospiro[2,3,5,6-tetrahydro-1H-s-indacene-7,1'-cyclopropane] |
| SMILES | O=[N+]([O-])c1c2c(cc3c1C1(CC3)CC1)CCC2 |
| InChI | InChI=1S/C14H15NO2/c16-15(17)13-11-3-1-2-9(11)8-10-4-5-14(6-7-14)12(10)13/h8H,1-7H2 |
| InChIKey | AFYCRVDKURCAKL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|