C11H13NO3 — CID 140896345
4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol (PubChem CID 140896345) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol.
| Compound Name | 4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol |
|---|---|
| PubChem CID | 140896345 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol |
| SMILES | O=[N+]([O-])c1c(O)ccc2c1CCCCC2 |
| InChI | InChI=1S/C11H13NO3/c13-10-7-6-8-4-2-1-3-5-9(8)11(10)12(14)15/h6-7,13H,1-5H2 |
| InChIKey | XZXHUTZJBYUZKG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|