C18H18N2O4 — CID 86689321
N-(1-nitro-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 86689321) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(1-nitro-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-(1-nitro-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 86689321 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(1-nitro-5,6,7,8-tetrahydronaphthalen-2-yl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc3c(c2)OCCO3)ccc2c1CCCC2 |
| InChI | InChI=1S/C18H18N2O4/c21-20(22)18-14-4-2-1-3-12(14)5-7-15(18)19-13-6-8-16-17(11-13)24-10-9-23-16/h5-8,11,19H,1-4,9-10H2 |
| InChIKey | XQHZAQKPWIUJDK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|