About 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine
3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine (PubChem CID 80768030) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine |
| PubChem CID | 80768030 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ccc3c(c2)CCC3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O2/c16-13-5-2-6-14(15(13)18(19)20)17-12-8-7-10-3-1-4-11(10)9-12/h2,5-9,17H,1,3-4,16H2 |
| InChIKey | NTQBMUFUDRGFMZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine?
The IUPAC name of 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine (CID 80768030) is 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine.
What is the SMILES notation for 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine?
The canonical SMILES for 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine is Nc1cccc(Nc2ccc3c(c2)CCC3)c1[N+](=O)[O-].
What is the InChIKey of 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine?
The InChIKey is NTQBMUFUDRGFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c16-13-5-2-6-14(15(13)18(19)20)17-12-8-7-10-3-1-4-11(10)9-12/h2,5-9,17H,1,3-4,16H2.
What are the key properties of 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine?
3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine has a molecular weight of 269.30 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzene-1,3-diamine is sourced from PubChem (CID 80768030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).