C15H15N3O2 — CID 107855416
3-N-(2,3-dihydro-1H-inden-2-yl)-2-nitrobenzene-1,3-diamine (PubChem CID 107855416) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-N-(2,3-dihydro-1H-inden-2-yl)-2-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-(2,3-dihydro-1H-inden-2-yl)-2-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 107855416 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-N-(2,3-dihydro-1H-inden-2-yl)-2-nitrobenzene-1,3-diamine |
| SMILES | Nc1cccc(NC2Cc3ccccc3C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O2/c16-13-6-3-7-14(15(13)18(19)20)17-12-8-10-4-1-2-5-11(10)9-12/h1-7,12,17H,8-9,16H2 |
| InChIKey | DCZVECVABVBAFD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|