C16H15NO4 — CID 62514114
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-methylbenzoic acid (PubChem CID 62514114) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-methylbenzoic acid.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 62514114 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-methylbenzoic acid |
| SMILES | Cc1ccc(Nc2ccc3c(c2)OCCO3)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H15NO4/c1-10-2-4-13(12(8-10)16(18)19)17-11-3-5-14-15(9-11)21-7-6-20-14/h2-5,8-9,17H,6-7H2,1H3,(H,18,19) |
| InChIKey | UQZHBSNNHYXNET-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |