C15H19NO5 — CID 70168547
ethyl 2-[(4-nitro-2,3-dihydro-1H-inden-5-yl)oxy]butanoate (PubChem CID 70168547) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 2-[(4-nitro-2,3-dihydro-1H-inden-5-yl)oxy]butanoate.
| Compound Name | ethyl 2-[(4-nitro-2,3-dihydro-1H-inden-5-yl)oxy]butanoate |
|---|---|
| PubChem CID | 70168547 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | ethyl 2-[(4-nitro-2,3-dihydro-1H-inden-5-yl)oxy]butanoate |
| SMILES | CCOC(=O)C(CC)Oc1ccc2c(c1[N+](=O)[O-])CCC2 |
| InChI | InChI=1S/C15H19NO5/c1-3-12(15(17)20-4-2)21-13-9-8-10-6-5-7-11(10)14(13)16(18)19/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | FLEZDDFUIDQXSO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|