C13H13NO6 — CID 67624355
2-[(4-nitro-3-oxo-1,2-dihydroinden-5-yl)oxy]butanoic acid (PubChem CID 67624355) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is 2-[(4-nitro-3-oxo-1,2-dihydroinden-5-yl)oxy]butanoic acid.
| Compound Name | 2-[(4-nitro-3-oxo-1,2-dihydroinden-5-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 67624355 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[(4-nitro-3-oxo-1,2-dihydroinden-5-yl)oxy]butanoic acid |
| SMILES | CCC(Oc1ccc2c(c1[N+](=O)[O-])C(=O)CC2)C(=O)O |
| InChI | InChI=1S/C13H13NO6/c1-2-9(13(16)17)20-10-6-4-7-3-5-8(15)11(7)12(10)14(18)19/h4,6,9H,2-3,5H2,1H3,(H,16,17) |
| InChIKey | NQOHXOBNQCUDHL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|