C10H9Cl2NO5 — CID 57418653
2-(4,5-dichloro-2-nitrophenoxy)butanoic acid (PubChem CID 57418653) has the molecular formula C10H9Cl2NO5 and a molecular weight of 294.09 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-nitrophenoxy)butanoic acid.
| Compound Name | 2-(4,5-dichloro-2-nitrophenoxy)butanoic acid |
|---|---|
| PubChem CID | 57418653 |
| Molecular Formula | C10H9Cl2NO5 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 2-(4,5-dichloro-2-nitrophenoxy)butanoic acid |
| SMILES | CCC(Oc1cc(Cl)c(Cl)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H9Cl2NO5/c1-2-8(10(14)15)18-9-4-6(12)5(11)3-7(9)13(16)17/h3-4,8H,2H2,1H3,(H,14,15) |
| InChIKey | FTPUODKSQJIQTI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|