C10H11Cl2NO4 — CID 107501296
3-(4,5-dichloro-2-nitrophenoxy)butan-2-ol (PubChem CID 107501296) has the molecular formula C10H11Cl2NO4 and a molecular weight of 280.11 g/mol. Its IUPAC name is 3-(4,5-dichloro-2-nitrophenoxy)butan-2-ol.
| Compound Name | 3-(4,5-dichloro-2-nitrophenoxy)butan-2-ol |
|---|---|
| PubChem CID | 107501296 |
| Molecular Formula | C10H11Cl2NO4 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 3-(4,5-dichloro-2-nitrophenoxy)butan-2-ol |
| SMILES | CC(O)C(C)Oc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11Cl2NO4/c1-5(14)6(2)17-10-4-8(12)7(11)3-9(10)13(15)16/h3-6,14H,1-2H3 |
| InChIKey | ROAPGORJEGVJSS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|