C14H16O4 — CID 70243662
2-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]butanoic acid (PubChem CID 70243662) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]butanoic acid.
| Compound Name | 2-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 70243662 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)oxy]butanoic acid |
| SMILES | CCC(Oc1ccc2c(c1)C(=O)CCC2)C(=O)O |
| InChI | InChI=1S/C14H16O4/c1-2-13(14(16)17)18-10-7-6-9-4-3-5-12(15)11(9)8-10/h6-8,13H,2-5H2,1H3,(H,16,17) |
| InChIKey | BXJCYONXJPLUHV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |