C13H15NO3 — CID 162394396
(4-nitro-1,2,3,5,6,7-hexahydro-s-indacen-2-yl)methanol (PubChem CID 162394396) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (4-nitro-1,2,3,5,6,7-hexahydro-s-indacen-2-yl)methanol.
| Compound Name | (4-nitro-1,2,3,5,6,7-hexahydro-s-indacen-2-yl)methanol |
|---|---|
| PubChem CID | 162394396 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (4-nitro-1,2,3,5,6,7-hexahydro-s-indacen-2-yl)methanol |
| SMILES | O=[N+]([O-])c1c2c(cc3c1CC(CO)C3)CCC2 |
| InChI | InChI=1S/C13H15NO3/c15-7-8-4-10-6-9-2-1-3-11(9)13(14(16)17)12(10)5-8/h6,8,15H,1-5,7H2 |
| InChIKey | GPZUKFFJLZUJRQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|