C24H25F2NO4 — CID 167661575
1-(6-fluoro-2,3-dihydro-1H-inden-5-yl)propan-2-one;1-(6-fluoro-4-nitro-2,3-dihydro-1H-inden-5-yl)propan-2-one (PubChem CID 167661575) has the molecular formula C24H25F2NO4 and a molecular weight of 429.46 g/mol. Its IUPAC name is 1-(6-fluoro-2,3-dihydro-1H-inden-5-yl)propan-2-one;1-(6-fluoro-4-nitro-2,3-dihydro-1H-inden-5-yl)propan-2-one.
| Compound Name | 1-(6-fluoro-2,3-dihydro-1H-inden-5-yl)propan-2-one;1-(6-fluoro-4-nitro-2,3-dihydro-1H-inden-5-yl)propan-2-one |
|---|---|
| PubChem CID | 167661575 |
| Molecular Formula | C24H25F2NO4 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-(6-fluoro-2,3-dihydro-1H-inden-5-yl)propan-2-one;1-(6-fluoro-4-nitro-2,3-dihydro-1H-inden-5-yl)propan-2-one |
| SMILES | CC(=O)Cc1c(F)cc2c(c1[N+](=O)[O-])CCC2.CC(=O)Cc1cc2c(cc1F)CCC2 |
| InChI | InChI=1S/C12H12FNO3.C12H13FO/c1-7(15)5-10-11(13)6-8-3-2-4-9(8)12(10)14(16)17;1-8(14)5-11-6-9-3-2-4-10(9)7-12(11)13/h6H,2-5H2,1H3;6-7H,2-5H2,1H3 |
| InChIKey | SAMKYYSQUATVNW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|