C24H23NO4 — CID 167700883
8-nitro-3,5,6,7-tetrahydro-2H-s-indacen-1-one;3,5,6,7-tetrahydro-2H-s-indacen-1-one (PubChem CID 167700883) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 8-nitro-3,5,6,7-tetrahydro-2H-s-indacen-1-one;3,5,6,7-tetrahydro-2H-s-indacen-1-one.
| Compound Name | 8-nitro-3,5,6,7-tetrahydro-2H-s-indacen-1-one;3,5,6,7-tetrahydro-2H-s-indacen-1-one |
|---|---|
| PubChem CID | 167700883 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 8-nitro-3,5,6,7-tetrahydro-2H-s-indacen-1-one;3,5,6,7-tetrahydro-2H-s-indacen-1-one |
| SMILES | O=C1CCc2cc3c(c([N+](=O)[O-])c21)CCC3.O=C1CCc2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C12H11NO3.C12H12O/c14-10-5-4-8-6-7-2-1-3-9(7)12(11(8)10)13(15)16;13-12-5-4-10-6-8-2-1-3-9(8)7-11(10)12/h6H,1-5H2;6-7H,1-5H2 |
| InChIKey | YJHAKMCRPUVLRL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|