About 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione
4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione (PubChem CID 118309693) has the molecular formula C11H8N2O4
and a molecular weight of 232.19 g/mol. Its IUPAC name is 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione |
| PubChem CID | 118309693 |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c3c(cc([N+](=O)[O-])c21)CCC3 |
| InChI | InChI=1S/C11H8N2O4/c14-10-8-6-3-1-2-5(6)4-7(13(16)17)9(8)11(15)12-10/h4H,1-3H2,(H,12,14,15) |
| InChIKey | AAHQCWANDXRRAU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione?
The IUPAC name of 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione (CID 118309693) is 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione.
What is the SMILES notation for 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione?
The canonical SMILES for 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione is O=C1NC(=O)c2c3c(cc([N+](=O)[O-])c21)CCC3.
What is the InChIKey of 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione?
The InChIKey is AAHQCWANDXRRAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O4/c14-10-8-6-3-1-2-5(6)4-7(13(16)17)9(8)11(15)12-10/h4H,1-3H2,(H,12,14,15).
What are the key properties of 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione?
4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione has a molecular weight of 232.19 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-7,8-dihydro-6H-cyclopenta[e]isoindole-1,3-dione is sourced from PubChem (CID 118309693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).