C10H8N2O4 — CID 103145278
4,7-dimethyl-5-nitro-1H-indole-2,3-dione (PubChem CID 103145278) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 4,7-dimethyl-5-nitro-1H-indole-2,3-dione.
| Compound Name | 4,7-dimethyl-5-nitro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 103145278 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4,7-dimethyl-5-nitro-1H-indole-2,3-dione |
| SMILES | Cc1cc([N+](=O)[O-])c(C)c2c1NC(=O)C2=O |
| InChI | InChI=1S/C10H8N2O4/c1-4-3-6(12(15)16)5(2)7-8(4)11-10(14)9(7)13/h3H,1-2H3,(H,11,13,14) |
| InChIKey | UQQHELMAMIESGQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|