C8H10BNO4 — CID 164643513
(3,4-dimethyl-5-nitrophenyl)boronic acid (PubChem CID 164643513) has the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. Its IUPAC name is (3,4-dimethyl-5-nitrophenyl)boronic acid.
| Compound Name | (3,4-dimethyl-5-nitrophenyl)boronic acid |
|---|---|
| PubChem CID | 164643513 |
| Molecular Formula | C8H10BNO4 |
| Molecular Weight | 194.98 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (3,4-dimethyl-5-nitrophenyl)boronic acid |
| SMILES | Cc1cc(B(O)O)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C8H10BNO4/c1-5-3-7(9(11)12)4-8(6(5)2)10(13)14/h3-4,11-12H,1-2H3 |
| InChIKey | HVVXXBGZBUTPHS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.98 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|