C7H6N2O6SY — CID 58860099
4-methyl-3,5-dinitrobenzenesulfinic acid;yttrium (PubChem CID 58860099) has the molecular formula C7H6N2O6SY and a molecular weight of 335.11 g/mol. Its IUPAC name is 4-methyl-3,5-dinitrobenzenesulfinic acid;yttrium.
| Compound Name | 4-methyl-3,5-dinitrobenzenesulfinic acid;yttrium |
|---|---|
| PubChem CID | 58860099 |
| Molecular Formula | C7H6N2O6SY |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 334.90 |
| IUPAC Name | 4-methyl-3,5-dinitrobenzenesulfinic acid;yttrium |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)O)cc1[N+](=O)[O-].[Y] |
| InChI | InChI=1S/C7H6N2O6S.Y/c1-4-6(8(10)11)2-5(16(14)15)3-7(4)9(12)13;/h2-3H,1H3,(H,14,15); |
| InChIKey | HETNKDVEXLMVHH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|