sodium 3,4-dimethyl-5-nitrobenzenesulfinate

C8H8NNaO4S — CID 114287125

IUPACsodium 3,4-dimethyl-5-nitrobenzenesulfinate
SMILESCc1cc(S(=O)[O-])cc([N+](=O)[O-])c1C.[Na+]
InChIInChI=1S/C8H9NO4S.Na/c1-5-3-7(14(12)13)4-8(6(5)2)9(10)11;/h3-4H,1-2H3,(H,12,13);/q;+1/p-1
InChIKeyNWWXSSQQLGHQSD-UHFFFAOYSA-M
MW237.21 g/mol
LogP-1.55
Rot. Bonds2

About sodium 3,4-dimethyl-5-nitrobenzenesulfinate

sodium 3,4-dimethyl-5-nitrobenzenesulfinate (PubChem CID 114287125) has the molecular formula C8H8NNaO4S and a molecular weight of 237.21 g/mol. Its IUPAC name is sodium 3,4-dimethyl-5-nitrobenzenesulfinate.

Molecular Properties

Compound Namesodium 3,4-dimethyl-5-nitrobenzenesulfinate
PubChem CID114287125
Molecular FormulaC8H8NNaO4S
Molecular Weight237.21 g/mol
Exact Mass237.01
IUPAC Namesodium 3,4-dimethyl-5-nitrobenzenesulfinate
SMILESCc1cc(S(=O)[O-])cc([N+](=O)[O-])c1C.[Na+]
InChIInChI=1S/C8H9NO4S.Na/c1-5-3-7(14(12)13)4-8(6(5)2)9(10)11;/h3-4H,1-2H3,(H,12,13);/q;+1/p-1
InChIKeyNWWXSSQQLGHQSD-UHFFFAOYSA-M
XLogP-1.55
TPSA83.27 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.21
LogP ≤ 5-1.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze sodium 3,4-dimethyl-5-nitrobenzenesulfinate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3,4-dimethyl-5-nitrobenzenesulfinate?
The IUPAC name of sodium 3,4-dimethyl-5-nitrobenzenesulfinate (CID 114287125) is sodium 3,4-dimethyl-5-nitrobenzenesulfinate.
What is the SMILES notation for sodium 3,4-dimethyl-5-nitrobenzenesulfinate?
The canonical SMILES for sodium 3,4-dimethyl-5-nitrobenzenesulfinate is Cc1cc(S(=O)[O-])cc([N+](=O)[O-])c1C.[Na+].
What is the InChIKey of sodium 3,4-dimethyl-5-nitrobenzenesulfinate?
The InChIKey is NWWXSSQQLGHQSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO4S.Na/c1-5-3-7(14(12)13)4-8(6(5)2)9(10)11;/h3-4H,1-2H3,(H,12,13);/q;+1/p-1.
What are the key properties of sodium 3,4-dimethyl-5-nitrobenzenesulfinate?
sodium 3,4-dimethyl-5-nitrobenzenesulfinate has a molecular weight of 237.21 g/mol, XLogP of -1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3,4-dimethyl-5-nitrobenzenesulfinate is sourced from PubChem (CID 114287125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).