C18H16Cl2N2O4 — CID 4231789
5-[2,2-dichloro-1-(3,4-dimethyl-5-nitrophenyl)ethenyl]-1,2-dimethyl-3-nitrobenzene (PubChem CID 4231789) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 5-[2,2-dichloro-1-(3,4-dimethyl-5-nitrophenyl)ethenyl]-1,2-dimethyl-3-nitrobenzene.
| Compound Name | 5-[2,2-dichloro-1-(3,4-dimethyl-5-nitrophenyl)ethenyl]-1,2-dimethyl-3-nitrobenzene |
|---|---|
| PubChem CID | 4231789 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-[2,2-dichloro-1-(3,4-dimethyl-5-nitrophenyl)ethenyl]-1,2-dimethyl-3-nitrobenzene |
| SMILES | Cc1cc(C(=C(Cl)Cl)c2cc(C)c(C)c([N+](=O)[O-])c2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-9-5-13(7-15(11(9)3)21(23)24)17(18(19)20)14-6-10(2)12(4)16(8-14)22(25)26/h5-8H,1-4H3 |
| InChIKey | FBHDVCBMWKOMRJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|